j023 j023
  • 02-08-2017
  • Mathematics
contestada

A company that creates model cars uses a 1.5 foot : 1 inch ration when creating the models. If a real car is 12 feet long, how long will the model car be?

Respuesta :

YanaMenes
YanaMenes YanaMenes
  • 02-08-2017
I believe the answer would be 8 inches.
Answer Link

Otras preguntas

In the calvin cycle, how many atp molecules are required to regenerate rubp from five g3p molecules?
Which process in the body is primarily controlled by testosterone?
What is an archetype?
A place where former drug abusers live to gether and learn to be drug free is called
What activities of a government go beyond their limited sphere?
What is an example of change on earth that people can see happening?
there are 12 people behind Danny one of those is Leo and there are 8 people ahead of Leo between Dany and Leo there are 5 people how many people are in the line
Patricia wishes to have a rectangular garden in her backyard. she has 60 ft of fencing with which to enclose her garden. letting x denote the width of the garde
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
a bag has 8 red marbles, 4 green marbles, and 2 yellow marbles. Bill draws a red marble from the bag and does not replace it. What is the probability of Bill dr